C25H28O6 — CID 21464766
1-[(2,4-dimethoxyphenyl)-methoxy-(2-methoxyphenyl)methyl]-2,4-dimethoxybenzene (PubChem CID 21464766) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)-methoxy-(2-methoxyphenyl)methyl]-2,4-dimethoxybenzene.
| Compound Name | 1-[(2,4-dimethoxyphenyl)-methoxy-(2-methoxyphenyl)methyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 21464766 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)-methoxy-(2-methoxyphenyl)methyl]-2,4-dimethoxybenzene |
| SMILES | COc1ccc(C(OC)(c2ccccc2OC)c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C25H28O6/c1-26-17-11-13-20(23(15-17)29-4)25(31-6,19-9-7-8-10-22(19)28-3)21-14-12-18(27-2)16-24(21)30-5/h7-16H,1-6H3 |
| InChIKey | CIOYARCLXNJTGD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|