C23H24N2O4 — CID 55362447
N-(2,5-dimethoxyphenyl)-2-(4-phenoxyanilino)propanamide (PubChem CID 55362447) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(4-phenoxyanilino)propanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 55362447 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(4-phenoxyanilino)propanamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(C)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H24N2O4/c1-16(23(26)25-21-15-20(27-2)13-14-22(21)28-3)24-17-9-11-19(12-10-17)29-18-7-5-4-6-8-18/h4-16,24H,1-3H3,(H,25,26) |
| InChIKey | OGGCVQPNAIALTM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |