C23H23ClN2O4 — CID 18289314
N-(2-chlorophenyl)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]propanamide (PubChem CID 18289314) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]propanamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]propanamide |
|---|---|
| PubChem CID | 18289314 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]propanamide |
| SMILES | COc1ccc(Oc2cc(NC(C)C(=O)Nc3ccccc3Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C23H23ClN2O4/c1-15(23(27)26-20-7-5-4-6-19(20)24)25-16-8-13-21(29-3)22(14-16)30-18-11-9-17(28-2)10-12-18/h4-15,25H,1-3H3,(H,26,27) |
| InChIKey | MGYKJRRUQIDOFZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|