C18H20Cl2N2O4 — CID 47005825
N-(2,3-dichlorophenyl)-2-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 47005825) has the molecular formula C18H20Cl2N2O4 and a molecular weight of 399.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 47005825 |
| Molecular Formula | C18H20Cl2N2O4 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NC(C)C(=O)Nc2cccc(Cl)c2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H20Cl2N2O4/c1-10(18(23)22-13-7-5-6-12(19)16(13)20)21-11-8-14(24-2)17(26-4)15(9-11)25-3/h5-10,21H,1-4H3,(H,22,23) |
| InChIKey | JRABHHDDNPSAOE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|