C19H20ClF3N2O4 — CID 46667030
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 46667030) has the molecular formula C19H20ClF3N2O4 and a molecular weight of 432.83 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 46667030 |
| Molecular Formula | C19H20ClF3N2O4 |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NC(C)C(=O)Nc2ccc(Cl)cc2C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C19H20ClF3N2O4/c1-10(24-12-8-15(27-2)17(29-4)16(9-12)28-3)18(26)25-14-6-5-11(20)7-13(14)19(21,22)23/h5-10,24H,1-4H3,(H,25,26) |
| InChIKey | JXKHOOIDNPFVNN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|