C24H26N2O5 — CID 30296852
(2R)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]-N-(3-methoxyphenyl)propanamide (PubChem CID 30296852) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (2R)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]-N-(3-methoxyphenyl)propanamide.
| Compound Name | (2R)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]-N-(3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 30296852 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2R)-2-[4-methoxy-3-(4-methoxyphenoxy)anilino]-N-(3-methoxyphenyl)propanamide |
| SMILES | COc1ccc(Oc2cc(N[C@H](C)C(=O)Nc3cccc(OC)c3)ccc2OC)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-16(24(27)26-17-6-5-7-21(14-17)29-3)25-18-8-13-22(30-4)23(15-18)31-20-11-9-19(28-2)10-12-20/h5-16,25H,1-4H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | LEZPXJQRSVCXIZ-MRXNPFEDSA-N |
| XLogP | 4.94 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|