C45H46N2O7 — CID 166550126
9H-fluoren-9-ylmethyl N-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[4-(hydroxymethyl)piperidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 166550126) has the molecular formula C45H46N2O7 and a molecular weight of 726.87 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[4-(hydroxymethyl)piperidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[4-(hydroxymethyl)piperidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 166550126 |
| Molecular Formula | C45H46N2O7 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.33 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[4-(hydroxymethyl)piperidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C(OC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)N2CCC(CO)CC2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H46N2O7/c1-51-35-20-16-33(17-21-35)45(32-10-4-3-5-11-32,34-18-22-36(52-2)23-19-34)54-30-42(43(49)47-26-24-31(28-48)25-27-47)46-44(50)53-29-41-39-14-8-6-12-37(39)38-13-7-9-15-40(38)41/h3-23,31,41-42,48H,24-30H2,1-2H3,(H,46,50)/t42-/m0/s1 |
| InChIKey | PHJFYEPEHBSWQI-WBCKFURZSA-N |
| XLogP | 7.15 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|