C42H36N4O6 — CID 101196623
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propanoic acid (PubChem CID 101196623) has the molecular formula C42H36N4O6 and a molecular weight of 692.77 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propanoic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 101196623 |
| Molecular Formula | C42H36N4O6 |
| Molecular Weight | 692.77 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propanoic acid |
| SMILES | COc1ccc(C(Nc2ccn(C[C@@H](NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)c(=O)n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H36N4O6/c1-51-31-22-20-30(21-23-31)42(28-12-4-2-5-13-28,29-14-6-3-7-15-29)45-38-24-25-46(40(49)44-38)26-37(39(47)48)43-41(50)52-27-36-34-18-10-8-16-32(34)33-17-9-11-19-35(33)36/h2-25,36-37H,26-27H2,1H3,(H,43,50)(H,47,48)(H,44,45,49)/t37-/m1/s1 |
| InChIKey | DVOZSNOOISZLRJ-DIPNUNPCSA-N |
| XLogP | 6.65 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.77 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|