C44H44N2O6 — CID 11636178
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoyl]-methylamino]-4-methylpentanoic acid (PubChem CID 11636178) has the molecular formula C44H44N2O6 and a molecular weight of 696.84 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoyl]-methylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoyl]-methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11636178 |
| Molecular Formula | C44H44N2O6 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoyl]-methylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)C(=O)[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C44H44N2O6/c1-30(2)27-40(42(48)49)46(3)41(47)39(45-43(50)51-28-38-36-25-15-13-23-34(36)35-24-14-16-26-37(35)38)29-52-44(31-17-7-4-8-18-31,32-19-9-5-10-20-32)33-21-11-6-12-22-33/h4-26,30,38-40H,27-29H2,1-3H3,(H,45,50)(H,48,49)/t39-,40-/m0/s1 |
| InChIKey | HVWUXSUEBRAQOI-ZAQUEYBZSA-N |
| XLogP | 7.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|