C30H40N2O6 — CID 118536535
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-hydroxyamino]-3,3-dimethyl-2-propan-2-ylbutanoic acid (PubChem CID 118536535) has the molecular formula C30H40N2O6 and a molecular weight of 524.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-hydroxyamino]-3,3-dimethyl-2-propan-2-ylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-hydroxyamino]-3,3-dimethyl-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 118536535 |
| Molecular Formula | C30H40N2O6 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-hydroxyamino]-3,3-dimethyl-2-propan-2-ylbutanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(O)[C@@](C(=O)O)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H40N2O6/c1-18(2)16-25(26(33)32(37)30(19(3)4,27(34)35)29(5,6)7)31-28(36)38-17-24-22-14-10-8-12-20(22)21-13-9-11-15-23(21)24/h8-15,18-19,24-25,37H,16-17H2,1-7H3,(H,31,36)(H,34,35)/t25-,30+/m0/s1 |
| InChIKey | RVUWLZDAVBNAAN-SETSBSEESA-N |
| XLogP | 5.68 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|