C26H32N2O5S — CID 175774041
ethyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoate (PubChem CID 175774041) has the molecular formula C26H32N2O5S and a molecular weight of 484.62 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 175774041 |
| Molecular Formula | C26H32N2O5S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | ethyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H32N2O5S/c1-4-32-25(30)22(13-16(2)3)27-24(29)23(15-34)28-26(31)33-14-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h5-12,16,21-23,34H,4,13-15H2,1-3H3,(H,27,29)(H,28,31)/t22-,23-/m0/s1 |
| InChIKey | RUXXFUQGYQKEFO-GOTSBHOMSA-N |
| XLogP | 3.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|