C42H40N2O5 — CID 51341573
[[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate (PubChem CID 51341573) has the molecular formula C42H40N2O5 and a molecular weight of 652.79 g/mol. Its IUPAC name is [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate.
| Compound Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 51341573 |
| Molecular Formula | C42H40N2O5 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate |
| SMILES | CNC(=O)c1ccc(C(OC(=O)[C@H](CC(C)C)NC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H40N2O5/c1-28(2)26-38(44-41(47)48-27-37-35-20-12-10-18-33(35)34-19-11-13-21-36(34)37)40(46)49-42(30-14-6-4-7-15-30,31-16-8-5-9-17-31)32-24-22-29(23-25-32)39(45)43-3/h4-25,28,37-38H,26-27H2,1-3H3,(H,43,45)(H,44,47)/t38-/m0/s1 |
| InChIKey | NLNNWEGNJBOJSO-LHEWISCISA-N |
| XLogP | 7.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|