C42H39N3O6S — CID 51341565
[[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 51341565) has the molecular formula C42H39N3O6S and a molecular weight of 713.86 g/mol. Its IUPAC name is [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 51341565 |
| Molecular Formula | C42H39N3O6S |
| Molecular Weight | 713.86 g/mol |
| Exact Mass | 713.26 |
| IUPAC Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CNC(=O)c1ccc(C(OC(=O)[C@H](CSCNC(C)=O)NC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H39N3O6S/c1-28(46)44-27-52-26-38(45-41(49)50-25-37-35-19-11-9-17-33(35)34-18-10-12-20-36(34)37)40(48)51-42(30-13-5-3-6-14-30,31-15-7-4-8-16-31)32-23-21-29(22-24-32)39(47)43-2/h3-24,37-38H,25-27H2,1-2H3,(H,43,47)(H,44,46)(H,45,49)/t38-/m0/s1 |
| InChIKey | GOTFQWWTRFZLDS-LHEWISCISA-N |
| XLogP | 6.62 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.86 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|