C38H52N2O11S — CID 10652605
[(E)-4-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]but-2-enyl] (2S)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 10652605) has the molecular formula C38H52N2O11S and a molecular weight of 744.90 g/mol. Its IUPAC name is [(E)-4-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]but-2-enyl] (2S)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | [(E)-4-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]but-2-enyl] (2S)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10652605 |
| Molecular Formula | C38H52N2O11S |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | [(E)-4-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]but-2-enyl] (2S)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC(=O)NCSC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC/C=C/COCCOCCOCCOCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H52N2O11S/c1-28(41)39-27-52-26-34(40-37(44)50-25-33-31-13-7-5-11-29(31)30-12-6-8-14-32(30)33)36(43)49-17-10-9-16-45-19-21-47-23-24-48-22-20-46-18-15-35(42)51-38(2,3)4/h5-14,33-34H,15-27H2,1-4H3,(H,39,41)(H,40,44)/b10-9+/t34-/m1/s1 |
| InChIKey | RXQGEFDMCDMBAM-BJIHVEFSSA-N |
| XLogP | 4.62 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|