C37H42N2O6 — CID 24872675
[4-amino-2-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexylcarbamoyl]phenyl]methyl acetate (PubChem CID 24872675) has the molecular formula C37H42N2O6 and a molecular weight of 610.75 g/mol. Its IUPAC name is [4-amino-2-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexylcarbamoyl]phenyl]methyl acetate.
| Compound Name | [4-amino-2-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexylcarbamoyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 24872675 |
| Molecular Formula | C37H42N2O6 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | [4-amino-2-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexylcarbamoyl]phenyl]methyl acetate |
| SMILES | COc1ccc(C(OCCCCCCNC(=O)c2cc(N)ccc2COC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H42N2O6/c1-27(40)44-26-28-13-18-32(38)25-35(28)36(41)39-23-9-4-5-10-24-45-37(29-11-7-6-8-12-29,30-14-19-33(42-2)20-15-30)31-16-21-34(43-3)22-17-31/h6-8,11-22,25H,4-5,9-10,23-24,26,38H2,1-3H3,(H,39,41) |
| InChIKey | YSPCTYXXVNGJCY-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|