C28H31NO4S — CID 140966966
methyl (2R)-3-sulfanyl-2-(5-trityloxypentanoylamino)propanoate (PubChem CID 140966966) has the molecular formula C28H31NO4S and a molecular weight of 477.63 g/mol. Its IUPAC name is methyl (2R)-3-sulfanyl-2-(5-trityloxypentanoylamino)propanoate.
| Compound Name | methyl (2R)-3-sulfanyl-2-(5-trityloxypentanoylamino)propanoate |
|---|---|
| PubChem CID | 140966966 |
| Molecular Formula | C28H31NO4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | methyl (2R)-3-sulfanyl-2-(5-trityloxypentanoylamino)propanoate |
| SMILES | COC(=O)[C@H](CS)NC(=O)CCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO4S/c1-32-27(31)25(21-34)29-26(30)19-11-12-20-33-28(22-13-5-2-6-14-22,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-10,13-18,25,34H,11-12,19-21H2,1H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | MYSREEXOKIPYCR-VWLOTQADSA-N |
| XLogP | 4.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|