C21H25N2O4PS — CID 90951435
methyl (2R)-2-[[2-(3-diphenylphosphanylpropanoylamino)acetyl]amino]-3-sulfanylpropanoate (PubChem CID 90951435) has the molecular formula C21H25N2O4PS and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(3-diphenylphosphanylpropanoylamino)acetyl]amino]-3-sulfanylpropanoate.
| Compound Name | methyl (2R)-2-[[2-(3-diphenylphosphanylpropanoylamino)acetyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 90951435 |
| Molecular Formula | C21H25N2O4PS |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | methyl (2R)-2-[[2-(3-diphenylphosphanylpropanoylamino)acetyl]amino]-3-sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CS)NC(=O)CNC(=O)CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N2O4PS/c1-27-21(26)18(15-29)23-20(25)14-22-19(24)12-13-28(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18,29H,12-15H2,1H3,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | MQSYPNZGFMZXEJ-SFHVURJKSA-N |
| XLogP | 1.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|