C9H11NO3S2 — CID 3042859
methyl (2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 3042859) has the molecular formula C9H11NO3S2 and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl (2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | methyl (2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 3042859 |
| Molecular Formula | C9H11NO3S2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | methyl (2R)-3-sulfanyl-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | COC(=O)[C@H](CS)NC(=O)c1cccs1 |
| InChI | InChI=1S/C9H11NO3S2/c1-13-9(12)6(5-14)10-8(11)7-3-2-4-15-7/h2-4,6,14H,5H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | WLIPIVYUXABDSI-LURJTMIESA-N |
| XLogP | 0.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|