C13H19NO3S — CID 125041848
ethyl (2S)-4-methyl-2-(thiophene-2-carbonylamino)pentanoate (PubChem CID 125041848) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-(thiophene-2-carbonylamino)pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-(thiophene-2-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 125041848 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | ethyl (2S)-4-methyl-2-(thiophene-2-carbonylamino)pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NC(=O)c1cccs1 |
| InChI | InChI=1S/C13H19NO3S/c1-4-17-13(16)10(8-9(2)3)14-12(15)11-6-5-7-18-11/h5-7,9-10H,4,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | BAIUQVREGVJCQI-JTQLQIEISA-N |
| XLogP | 2.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |