C14H19NO5S — CID 9199388
[2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 9199388) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 9199388 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)c1cccs1 |
| InChI | InChI=1S/C14H19NO5S/c1-9(2)7-10(13(17)19-3)15-12(16)8-20-14(18)11-5-4-6-21-11/h4-6,9-10H,7-8H2,1-3H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | XTPYLMPNSZERDV-SNVBAGLBSA-N |
| XLogP | 1.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |