C29H36N2O2 — CID 143766390
(4S)-4-(methylamino)-N-propan-2-yl-6-trityloxyhexanamide (PubChem CID 143766390) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is (4S)-4-(methylamino)-N-propan-2-yl-6-trityloxyhexanamide.
| Compound Name | (4S)-4-(methylamino)-N-propan-2-yl-6-trityloxyhexanamide |
|---|---|
| PubChem CID | 143766390 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | (4S)-4-(methylamino)-N-propan-2-yl-6-trityloxyhexanamide |
| SMILES | CN[C@H](CCOC(c1ccccc1)(c1ccccc1)c1ccccc1)CCC(=O)NC(C)C |
| InChI | InChI=1S/C29H36N2O2/c1-23(2)31-28(32)20-19-27(30-3)21-22-33-29(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-18,23,27,30H,19-22H2,1-3H3,(H,31,32)/t27-/m0/s1 |
| InChIKey | YVOQWJZCPZMRSG-MHZLTWQESA-N |
| XLogP | 5.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|