C27H30O4 — CID 10971817
[(3R,4S)-4-hydroxy-6-trityloxyhexan-3-yl] acetate (PubChem CID 10971817) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-6-trityloxyhexan-3-yl] acetate.
| Compound Name | [(3R,4S)-4-hydroxy-6-trityloxyhexan-3-yl] acetate |
|---|---|
| PubChem CID | 10971817 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(3R,4S)-4-hydroxy-6-trityloxyhexan-3-yl] acetate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](O)CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O4/c1-3-26(31-21(2)28)25(29)19-20-30-27(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,25-26,29H,3,19-20H2,1-2H3/t25-,26+/m0/s1 |
| InChIKey | PUTBFGJJQVLQJC-IZZNHLLZSA-N |
| XLogP | 5.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|