C33H34O10 — CID 22295124
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-oxo-1-trityloxyhexan-2-yl] acetate (PubChem CID 22295124) has the molecular formula C33H34O10 and a molecular weight of 590.62 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-oxo-1-trityloxyhexan-2-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-oxo-1-trityloxyhexan-2-yl] acetate |
|---|---|
| PubChem CID | 22295124 |
| Molecular Formula | C33H34O10 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-oxo-1-trityloxyhexan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@H](C=O)OC(C)=O)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C33H34O10/c1-22(35)40-29(20-34)31(42-24(3)37)32(43-25(4)38)30(41-23(2)36)21-39-33(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-20,29-32H,21H2,1-4H3/t29-,30+,31+,32-/m0/s1 |
| InChIKey | XRICESLJZCPQGJ-BVEPWEIPSA-N |
| XLogP | 3.92 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|