C27H30O5 — CID 101467862
(2S,3R,4R)-2,3,4-trimethoxy-5-trityloxypentanal (PubChem CID 101467862) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4-trimethoxy-5-trityloxypentanal.
| Compound Name | (2S,3R,4R)-2,3,4-trimethoxy-5-trityloxypentanal |
|---|---|
| PubChem CID | 101467862 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2S,3R,4R)-2,3,4-trimethoxy-5-trityloxypentanal |
| SMILES | CO[C@@H]([C@@H](C=O)OC)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C27H30O5/c1-29-24(19-28)26(31-3)25(30-2)20-32-27(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-19,24-26H,20H2,1-3H3/t24-,25-,26+/m1/s1 |
| InChIKey | GIEZQZONYQTGOR-CYXNTTPDSA-N |
| XLogP | 4.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|