C32H42O3Si — CID 10601557
(2R,3R,4S)-2,4-dimethyl-3-triethylsilyloxy-5-trityloxypentanal (PubChem CID 10601557) has the molecular formula C32H42O3Si and a molecular weight of 502.77 g/mol. Its IUPAC name is (2R,3R,4S)-2,4-dimethyl-3-triethylsilyloxy-5-trityloxypentanal.
| Compound Name | (2R,3R,4S)-2,4-dimethyl-3-triethylsilyloxy-5-trityloxypentanal |
|---|---|
| PubChem CID | 10601557 |
| Molecular Formula | C32H42O3Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (2R,3R,4S)-2,4-dimethyl-3-triethylsilyloxy-5-trityloxypentanal |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)C=O)[C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H42O3Si/c1-6-36(7-2,8-3)35-31(26(4)24-33)27(5)25-34-32(28-18-12-9-13-19-28,29-20-14-10-15-21-29)30-22-16-11-17-23-30/h9-24,26-27,31H,6-8,25H2,1-5H3/t26-,27-,31-/m0/s1 |
| InChIKey | JUWJMDFXONAHKC-HEWUYBSCSA-N |
| XLogP | 7.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|