C40H57BO2Si — CID 10770019
[(2S,3S,4S)-1-(9-borabicyclo[3.3.1]nonan-9-yl)-2,4-dimethyl-5-trityloxypentan-3-yl]oxy-triethylsilane (PubChem CID 10770019) has the molecular formula C40H57BO2Si and a molecular weight of 608.79 g/mol. Its IUPAC name is [(2S,3S,4S)-1-(9-borabicyclo[3.3.1]nonan-9-yl)-2,4-dimethyl-5-trityloxypentan-3-yl]oxy-triethylsilane.
| Compound Name | [(2S,3S,4S)-1-(9-borabicyclo[3.3.1]nonan-9-yl)-2,4-dimethyl-5-trityloxypentan-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10770019 |
| Molecular Formula | C40H57BO2Si |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.42 |
| IUPAC Name | [(2S,3S,4S)-1-(9-borabicyclo[3.3.1]nonan-9-yl)-2,4-dimethyl-5-trityloxypentan-3-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](C)CB1C2CCCC1CCC2 |
| InChI | InChI=1S/C40H57BO2Si/c1-6-44(7-2,8-3)43-39(32(4)30-41-37-26-18-27-38(41)29-19-28-37)33(5)31-42-40(34-20-12-9-13-21-34,35-22-14-10-15-23-35)36-24-16-11-17-25-36/h9-17,20-25,32-33,37-39H,6-8,18-19,26-31H2,1-5H3/t32-,33-,37?,38?,39-/m0/s1 |
| InChIKey | QHXPZLLLYNTOMP-JLAZEDHNSA-N |
| XLogP | 11.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|