C28H32O5S2 — CID 71658947
(1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-5-trityloxypentane-1,2,3,4-tetrol (PubChem CID 71658947) has the molecular formula C28H32O5S2 and a molecular weight of 512.69 g/mol. Its IUPAC name is (1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-5-trityloxypentane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-5-trityloxypentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 71658947 |
| Molecular Formula | C28H32O5S2 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (1R,2R,3S,4R)-1-(1,3-dithian-2-yl)-5-trityloxypentane-1,2,3,4-tetrol |
| SMILES | O[C@H]([C@@H](O)[C@@H](O)C1SCCCS1)[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O5S2/c29-23(24(30)25(31)26(32)27-34-17-10-18-35-27)19-33-28(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23-27,29-32H,10,17-19H2/t23-,24+,25-,26-/m1/s1 |
| InChIKey | CLFIBAVCPNIUHE-XDZVQPMWSA-N |
| XLogP | 3.63 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|