C62H72O4S2Si2 — CID 15441858
(2R,3R)-3-[2-[(2R)-2,3-bis[[tert-butyl(diphenyl)silyl]oxy]propyl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol (PubChem CID 15441858) has the molecular formula C62H72O4S2Si2 and a molecular weight of 1001.56 g/mol. Its IUPAC name is (2R,3R)-3-[2-[(2R)-2,3-bis[[tert-butyl(diphenyl)silyl]oxy]propyl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol.
| Compound Name | (2R,3R)-3-[2-[(2R)-2,3-bis[[tert-butyl(diphenyl)silyl]oxy]propyl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol |
|---|---|
| PubChem CID | 15441858 |
| Molecular Formula | C62H72O4S2Si2 |
| Molecular Weight | 1001.56 g/mol |
| Exact Mass | 1000.44 |
| IUPAC Name | (2R,3R)-3-[2-[(2R)-2,3-bis[[tert-butyl(diphenyl)silyl]oxy]propyl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol |
| SMILES | C[C@H]([C@@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1)C1(C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C62H72O4S2Si2/c1-49(58(63)48-64-62(50-30-15-8-16-31-50,51-32-17-9-18-33-51)52-34-19-10-20-35-52)61(67-44-29-45-68-61)46-53(66-70(60(5,6)7,56-40-25-13-26-41-56)57-42-27-14-28-43-57)47-65-69(59(2,3)4,54-36-21-11-22-37-54)55-38-23-12-24-39-55/h8-28,30-43,49,53,58,63H,29,44-48H2,1-7H3/t49-,53-,58+/m1/s1 |
| InChIKey | BMUYONVDZQKVRZ-WBCBQVFZSA-N |
| XLogP | 12.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.56 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|