C42H48O6Si — CID 142497056
2-[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyethanol (PubChem CID 142497056) has the molecular formula C42H48O6Si and a molecular weight of 676.93 g/mol. Its IUPAC name is 2-[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyethanol.
| Compound Name | 2-[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyethanol |
|---|---|
| PubChem CID | 142497056 |
| Molecular Formula | C42H48O6Si |
| Molecular Weight | 676.93 g/mol |
| Exact Mass | 676.32 |
| IUPAC Name | 2-[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxyethanol |
| SMILES | COc1ccc(C(OC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCCO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H48O6Si/c1-41(2,3)49(39-17-11-7-12-18-39,40-19-13-8-14-20-40)48-32-38(46-30-29-43)31-47-42(33-15-9-6-10-16-33,34-21-25-36(44-4)26-22-34)35-23-27-37(45-5)28-24-35/h6-28,38,43H,29-32H2,1-5H3/t38-/m1/s1 |
| InChIKey | CKIHGMADRMNNDU-KXQOOQHDSA-N |
| XLogP | 6.97 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.93 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|