C31H44O4S2Si — CID 102576973
[2-[tert-butyl(diphenyl)silyl]oxy-1-[2-[(2S,3S,4R)-3-hydroxy-4-methylhex-5-en-2-yl]-1,3-dithian-2-yl]ethyl] acetate (PubChem CID 102576973) has the molecular formula C31H44O4S2Si and a molecular weight of 572.91 g/mol. Its IUPAC name is [2-[tert-butyl(diphenyl)silyl]oxy-1-[2-[(2S,3S,4R)-3-hydroxy-4-methylhex-5-en-2-yl]-1,3-dithian-2-yl]ethyl] acetate.
| Compound Name | [2-[tert-butyl(diphenyl)silyl]oxy-1-[2-[(2S,3S,4R)-3-hydroxy-4-methylhex-5-en-2-yl]-1,3-dithian-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 102576973 |
| Molecular Formula | C31H44O4S2Si |
| Molecular Weight | 572.91 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | [2-[tert-butyl(diphenyl)silyl]oxy-1-[2-[(2S,3S,4R)-3-hydroxy-4-methylhex-5-en-2-yl]-1,3-dithian-2-yl]ethyl] acetate |
| SMILES | C=C[C@@H](C)[C@H](O)[C@H](C)C1(C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)=O)SCCCS1 |
| InChI | InChI=1S/C31H44O4S2Si/c1-8-23(2)29(33)24(3)31(36-20-15-21-37-31)28(35-25(4)32)22-34-38(30(5,6)7,26-16-11-9-12-17-26)27-18-13-10-14-19-27/h8-14,16-19,23-24,28-29,33H,1,15,20-22H2,2-7H3/t23-,24+,28?,29+/m1/s1 |
| InChIKey | UFJLXYRJAPGQKL-WKIJADAOSA-N |
| XLogP | 5.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|