C36H38O4S2 — CID 10579446
(E,3S,4R)-1-(1,3-dithian-2-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-4-phenylmethoxypent-1-en-3-ol (PubChem CID 10579446) has the molecular formula C36H38O4S2 and a molecular weight of 598.83 g/mol. Its IUPAC name is (E,3S,4R)-1-(1,3-dithian-2-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-4-phenylmethoxypent-1-en-3-ol.
| Compound Name | (E,3S,4R)-1-(1,3-dithian-2-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-4-phenylmethoxypent-1-en-3-ol |
|---|---|
| PubChem CID | 10579446 |
| Molecular Formula | C36H38O4S2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | (E,3S,4R)-1-(1,3-dithian-2-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-4-phenylmethoxypent-1-en-3-ol |
| SMILES | COc1ccc(C(OC[C@@H](OCc2ccccc2)[C@@H](O)/C=C/C2SCCCS2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H38O4S2/c1-38-32-20-18-31(19-21-32)36(29-14-7-3-8-15-29,30-16-9-4-10-17-30)40-27-34(39-26-28-12-5-2-6-13-28)33(37)22-23-35-41-24-11-25-42-35/h2-10,12-23,33-35,37H,11,24-27H2,1H3/b23-22+/t33-,34+/m0/s1 |
| InChIKey | UFRMJMDUPNVLAO-NQZXWIDKSA-N |
| XLogP | 7.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|