C36H34O5 — CID 10325161
(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(4-phenoxyphenyl)methoxy]propan-2-ol (PubChem CID 10325161) has the molecular formula C36H34O5 and a molecular weight of 546.66 g/mol. Its IUPAC name is (2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(4-phenoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(4-phenoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 10325161 |
| Molecular Formula | C36H34O5 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(4-phenoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1ccc(C(OC[C@@H](O)COCc2ccc(Oc3ccccc3)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H34O5/c1-38-33-23-19-31(20-24-33)36(29-11-5-2-6-12-29,30-13-7-3-8-14-30)40-27-32(37)26-39-25-28-17-21-35(22-18-28)41-34-15-9-4-10-16-34/h2-24,32,37H,25-27H2,1H3/t32-/m0/s1 |
| InChIKey | CXESKJWYWLDFOW-YTTGMZPUSA-N |
| XLogP | 7.37 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|