C16H22O3S2 — CID 10782406
(E,2R,3S)-5-(1,3-dithian-2-yl)-2-phenylmethoxypent-4-ene-1,3-diol (PubChem CID 10782406) has the molecular formula C16H22O3S2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (E,2R,3S)-5-(1,3-dithian-2-yl)-2-phenylmethoxypent-4-ene-1,3-diol.
| Compound Name | (E,2R,3S)-5-(1,3-dithian-2-yl)-2-phenylmethoxypent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 10782406 |
| Molecular Formula | C16H22O3S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (E,2R,3S)-5-(1,3-dithian-2-yl)-2-phenylmethoxypent-4-ene-1,3-diol |
| SMILES | OC[C@@H](OCc1ccccc1)[C@@H](O)/C=C/C1SCCCS1 |
| InChI | InChI=1S/C16H22O3S2/c17-11-15(19-12-13-5-2-1-3-6-13)14(18)7-8-16-20-9-4-10-21-16/h1-3,5-8,14-18H,4,9-12H2/b8-7+/t14-,15+/m0/s1 |
| InChIKey | YLQVYMNGLUDYCA-MHKRFPNSSA-N |
| XLogP | 2.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|