C25H28O6 — CID 11761668
(2S,3S,4S,5R)-6-trityloxyhexane-1,2,3,4,5-pentol (PubChem CID 11761668) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-trityloxyhexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3S,4S,5R)-6-trityloxyhexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 11761668 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (2S,3S,4S,5R)-6-trityloxyhexane-1,2,3,4,5-pentol |
| SMILES | OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28O6/c26-16-21(27)23(29)24(30)22(28)17-31-25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-24,26-30H,16-17H2/t21-,22+,23-,24-/m0/s1 |
| InChIKey | KOLQKHZCCPMGNH-KIHHCIJBSA-N |
| XLogP | 1.43 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|