C10H22O6 — CID 170654409
(2R,3R,4R,5R)-6-[(2-methylpropan-2-yl)oxy]hexane-1,2,3,4,5-pentol (PubChem CID 170654409) has the molecular formula C10H22O6 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2R,3R,4R,5R)-6-[(2-methylpropan-2-yl)oxy]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5R)-6-[(2-methylpropan-2-yl)oxy]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 170654409 |
| Molecular Formula | C10H22O6 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2R,3R,4R,5R)-6-[(2-methylpropan-2-yl)oxy]hexane-1,2,3,4,5-pentol |
| SMILES | CC(C)(C)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H22O6/c1-10(2,3)16-5-7(13)9(15)8(14)6(12)4-11/h6-9,11-15H,4-5H2,1-3H3/t6-,7-,8-,9-/m1/s1 |
| InChIKey | YWYMZVHAAHNXDG-FNCVBFRFSA-N |
| XLogP | -1.76 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |