C7H16O6 — CID 140946024
(2S,3R,4R,5R)-6-(deuteriomethoxy)hexane-1,2,3,4,5-pentol (PubChem CID 140946024) has the molecular formula C7H16O6 and a molecular weight of 197.21 g/mol. Its IUPAC name is (2S,3R,4R,5R)-6-(deuteriomethoxy)hexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3R,4R,5R)-6-(deuteriomethoxy)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 140946024 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2S,3R,4R,5R)-6-(deuteriomethoxy)hexane-1,2,3,4,5-pentol |
| SMILES | [2H]COC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C7H16O6/c1-13-3-5(10)7(12)6(11)4(9)2-8/h4-12H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1/i1D |
| InChIKey | PUTTXFZTELBTST-FLVFXGKWSA-N |
| XLogP | -2.93 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |