C7H19NO6+2 — CID 90358888
hydron;(2R,3R,4R,5S)-6-(methylaminooxy)hexane-1,2,3,4,5-pentol (PubChem CID 90358888) has the molecular formula C7H19NO6+2 and a molecular weight of 213.23 g/mol. Its IUPAC name is hydron;(2R,3R,4R,5S)-6-(methylaminooxy)hexane-1,2,3,4,5-pentol.
| Compound Name | hydron;(2R,3R,4R,5S)-6-(methylaminooxy)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 90358888 |
| Molecular Formula | C7H19NO6+2 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | hydron;(2R,3R,4R,5S)-6-(methylaminooxy)hexane-1,2,3,4,5-pentol |
| SMILES | CNOC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H+].[H+] |
| InChI | InChI=1S/C7H17NO6/c1-8-14-3-5(11)7(13)6(12)4(10)2-9/h4-13H,2-3H2,1H3/p+2/t4-,5+,6-,7-/m1/s1 |
| InChIKey | HQEQWDJZDJYUQA-XZBKPIIZSA-P |
| XLogP | -3.20 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|