C26H26O5 — CID 101221967
(2R,3R,4R,5S)-1-trityloxyhept-6-yne-2,3,4,5-tetrol (PubChem CID 101221967) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-trityloxyhept-6-yne-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5S)-1-trityloxyhept-6-yne-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 101221967 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (2R,3R,4R,5S)-1-trityloxyhept-6-yne-2,3,4,5-tetrol |
| SMILES | C#C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26O5/c1-2-22(27)24(29)25(30)23(28)18-31-26(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h1,3-17,22-25,27-30H,18H2/t22-,23+,24+,25+/m0/s1 |
| InChIKey | TVYGQGSBTOSPSN-ZYQDXHPFSA-N |
| XLogP | 2.07 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|