C38H40O2S — CID 46209681
(1R,2S)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-ol (PubChem CID 46209681) has the molecular formula C38H40O2S and a molecular weight of 560.80 g/mol. Its IUPAC name is (1R,2S)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-ol.
| Compound Name | (1R,2S)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-ol |
|---|---|
| PubChem CID | 46209681 |
| Molecular Formula | C38H40O2S |
| Molecular Weight | 560.80 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | (1R,2S)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-ol |
| SMILES | O[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](SC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C38H40O2S/c39-35(36(31-13-5-1-6-14-31)41-37-24-28-21-29(25-37)23-30(22-28)26-37)27-40-38(32-15-7-2-8-16-32,33-17-9-3-10-18-33)34-19-11-4-12-20-34/h1-20,28-30,35-36,39H,21-27H2/t28?,29?,30?,35-,36+,37?/m0/s1 |
| InChIKey | STGAVMYZBIIMSM-ZNBQDDAASA-N |
| XLogP | 8.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.80 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|