C19H26O2S — CID 46211661
(2S,3R)-3-(1-adamantylsulfanyl)-3-phenylpropane-1,2-diol (PubChem CID 46211661) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is (2S,3R)-3-(1-adamantylsulfanyl)-3-phenylpropane-1,2-diol.
| Compound Name | (2S,3R)-3-(1-adamantylsulfanyl)-3-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 46211661 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2S,3R)-3-(1-adamantylsulfanyl)-3-phenylpropane-1,2-diol |
| SMILES | OC[C@H](O)[C@H](SC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C19H26O2S/c20-12-17(21)18(16-4-2-1-3-5-16)22-19-9-13-6-14(10-19)8-15(7-13)11-19/h1-5,13-15,17-18,20-21H,6-12H2/t13?,14?,15?,17-,18+,19?/m0/s1 |
| InChIKey | ZLCZOXRLRDCFPC-QMTUAOIMSA-N |
| XLogP | 3.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |