C50H49O2PS — CID 46209815
[(1R,2R)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-yl]oxy-diphenylphosphane (PubChem CID 46209815) has the molecular formula C50H49O2PS and a molecular weight of 744.98 g/mol. Its IUPAC name is [(1R,2R)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-yl]oxy-diphenylphosphane.
| Compound Name | [(1R,2R)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-yl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 46209815 |
| Molecular Formula | C50H49O2PS |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 744.32 |
| IUPAC Name | [(1R,2R)-1-(1-adamantylsulfanyl)-1-phenyl-3-trityloxypropan-2-yl]oxy-diphenylphosphane |
| SMILES | c1ccc([C@@H](SC23CC4CC(CC(C4)C2)C3)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OP(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H49O2PS/c1-7-19-41(20-8-1)48(54-49-34-38-31-39(35-49)33-40(32-38)36-49)47(52-53(45-27-15-5-16-28-45)46-29-17-6-18-30-46)37-51-50(42-21-9-2-10-22-42,43-23-11-3-12-24-43)44-25-13-4-14-26-44/h1-30,38-40,47-48H,31-37H2/t38?,39?,40?,47-,48-,49?/m1/s1 |
| InChIKey | GKHHRCAMWQFZEK-CJTIHOGPSA-N |
| XLogP | 11.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|