C24H22F2O3 — CID 123952191
(5R)-3,3-difluoro-5-(trityloxymethyl)oxolan-2-ol (PubChem CID 123952191) has the molecular formula C24H22F2O3 and a molecular weight of 396.43 g/mol. Its IUPAC name is (5R)-3,3-difluoro-5-(trityloxymethyl)oxolan-2-ol.
| Compound Name | (5R)-3,3-difluoro-5-(trityloxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 123952191 |
| Molecular Formula | C24H22F2O3 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (5R)-3,3-difluoro-5-(trityloxymethyl)oxolan-2-ol |
| SMILES | OC1O[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1(F)F |
| InChI | InChI=1S/C24H22F2O3/c25-23(26)16-21(29-22(23)27)17-28-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-22,27H,16-17H2/t21-,22?/m1/s1 |
| InChIKey | SUASARISVMZSMN-ZMFCMNQTSA-N |
| XLogP | 4.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|