C26H28O3 — CID 56627536
(2R,6R)-2-methoxy-6-(trityloxymethyl)oxane (PubChem CID 56627536) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is (2R,6R)-2-methoxy-6-(trityloxymethyl)oxane.
| Compound Name | (2R,6R)-2-methoxy-6-(trityloxymethyl)oxane |
|---|---|
| PubChem CID | 56627536 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (2R,6R)-2-methoxy-6-(trityloxymethyl)oxane |
| SMILES | CO[C@H]1CCC[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C26H28O3/c1-27-25-19-11-18-24(29-25)20-28-26(21-12-5-2-6-13-21,22-14-7-3-8-15-22)23-16-9-4-10-17-23/h2-10,12-17,24-25H,11,18-20H2,1H3/t24-,25-/m1/s1 |
| InChIKey | VLOYLRNISFGYSN-JWQCQUIFSA-N |
| XLogP | 5.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|