C28H30O5 — CID 18716197
2-[(4R,6S)-2,2-dimethyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]acetic acid (PubChem CID 18716197) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-[(4R,6S)-2,2-dimethyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]acetic acid.
| Compound Name | 2-[(4R,6S)-2,2-dimethyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 18716197 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[(4R,6S)-2,2-dimethyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]acetic acid |
| SMILES | CC1(C)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C28H30O5/c1-27(2)32-24(19-26(29)30)18-25(33-27)20-31-28(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,24-25H,18-20H2,1-2H3,(H,29,30)/t24-,25+/m1/s1 |
| InChIKey | DSZYXIOIGWPVJI-RPBOFIJWSA-N |
| XLogP | 5.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|