C24H23IO2 — CID 102467326
(2R,3R)-2-(iodomethyl)-2-methyl-3-(trityloxymethyl)oxirane (PubChem CID 102467326) has the molecular formula C24H23IO2 and a molecular weight of 470.35 g/mol. Its IUPAC name is (2R,3R)-2-(iodomethyl)-2-methyl-3-(trityloxymethyl)oxirane.
| Compound Name | (2R,3R)-2-(iodomethyl)-2-methyl-3-(trityloxymethyl)oxirane |
|---|---|
| PubChem CID | 102467326 |
| Molecular Formula | C24H23IO2 |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | (2R,3R)-2-(iodomethyl)-2-methyl-3-(trityloxymethyl)oxirane |
| SMILES | C[C@@]1(CI)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23IO2/c1-23(18-25)22(27-23)17-26-24(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22H,17-18H2,1H3/t22-,23+/m1/s1 |
| InChIKey | ZLGQXKZDWHLNNB-PKTZIBPZSA-N |
| XLogP | 5.59 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|