C30H32N2O5 — CID 101173104
(3aR,5S,6R,6aR)-2,2-dimethyl-5-(trityloxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-piperazine]-2'-one (PubChem CID 101173104) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-2,2-dimethyl-5-(trityloxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-piperazine]-2'-one.
| Compound Name | (3aR,5S,6R,6aR)-2,2-dimethyl-5-(trityloxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-piperazine]-2'-one |
|---|---|
| PubChem CID | 101173104 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (3aR,5S,6R,6aR)-2,2-dimethyl-5-(trityloxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-piperazine]-2'-one |
| SMILES | CC1(C)O[C@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@]3(CNC(=O)CN3)[C@H]2O1 |
| InChI | InChI=1S/C30H32N2O5/c1-28(2)36-26-27(37-28)35-24(29(26)20-31-25(33)18-32-29)19-34-30(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,24,26-27,32H,18-20H2,1-2H3,(H,31,33)/t24-,26+,27-,29-/m1/s1 |
| InChIKey | SMHHPRHAIMGWEG-SQCBCDKRSA-N |
| XLogP | 3.33 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|