C34H39NO6Si — CID 23244633
(4S)-4-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-3-methylidene-4-trimethylsilylazetidin-2-one (PubChem CID 23244633) has the molecular formula C34H39NO6Si and a molecular weight of 585.77 g/mol. Its IUPAC name is (4S)-4-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-3-methylidene-4-trimethylsilylazetidin-2-one.
| Compound Name | (4S)-4-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-3-methylidene-4-trimethylsilylazetidin-2-one |
|---|---|
| PubChem CID | 23244633 |
| Molecular Formula | C34H39NO6Si |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | (4S)-4-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-3-methylidene-4-trimethylsilylazetidin-2-one |
| SMILES | C=C1C(=O)N[C@@]1(O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C34H39NO6Si/c1-23-30(36)35-34(23,42(4,5)6)40-28-27(38-31-29(28)39-32(2,3)41-31)22-37-33(24-16-10-7-11-17-24,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21,27-29,31H,1,22H2,2-6H3,(H,35,36)/t27-,28+,29-,31-,34+/m1/s1 |
| InChIKey | LDSBNGFAIMGONX-NEBVFVISSA-N |
| XLogP | 5.52 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|