C30H28NO5- — CID 135712955
[2-[(3aS,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxoprop-1-enylidene]azanide (PubChem CID 135712955) has the molecular formula C30H28NO5- and a molecular weight of 482.56 g/mol. Its IUPAC name is [2-[(3aS,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxoprop-1-enylidene]azanide.
| Compound Name | [2-[(3aS,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxoprop-1-enylidene]azanide |
|---|---|
| PubChem CID | 135712955 |
| Molecular Formula | C30H28NO5- |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [2-[(3aS,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-oxoprop-1-enylidene]azanide |
| SMILES | CC1(C)O[C@@H]2[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)OC(C(=C=[N-])C=O)[C@@H]2O1 |
| InChI | InChI=1S/C30H28NO5/c1-29(2)35-27-25(34-26(28(27)36-29)21(18-31)19-32)20-33-30(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,19,25-28H,20H2,1-2H3/q-1/t25-,26?,27-,28+/m1/s1 |
| InChIKey | DABYUIJZDAWUFG-UBOLQYRXSA-N |
| XLogP | 4.65 |
| TPSA | 76.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|