C33H33ClN2O4 — CID 134931384
4-[[(3aR,4R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-2-methylpyrimidine (PubChem CID 134931384) has the molecular formula C33H33ClN2O4 and a molecular weight of 557.09 g/mol. Its IUPAC name is 4-[[(3aR,4R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-2-methylpyrimidine.
| Compound Name | 4-[[(3aR,4R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-2-methylpyrimidine |
|---|---|
| PubChem CID | 134931384 |
| Molecular Formula | C33H33ClN2O4 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 4-[[(3aR,4R,6aS)-2,2-dimethyl-4-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-6-chloro-2-methylpyrimidine |
| SMILES | Cc1nc(Cl)cc(CC2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]3OC(C)(C)O[C@@H]23)n1 |
| InChI | InChI=1S/C33H33ClN2O4/c1-22-35-26(20-29(34)36-22)19-27-30-31(40-32(2,3)39-30)28(38-27)21-37-33(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,20,27-28,30-31H,19,21H2,1-3H3/t27?,28-,30+,31-/m1/s1 |
| InChIKey | POTPMYHZJCUYAU-LFXYWRJQSA-N |
| XLogP | 6.28 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|