C32H30IN5O4 — CID 10794610
9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-iodopurin-6-amine (PubChem CID 10794610) has the molecular formula C32H30IN5O4 and a molecular weight of 675.53 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-iodopurin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-iodopurin-6-amine |
|---|---|
| PubChem CID | 10794610 |
| Molecular Formula | C32H30IN5O4 |
| Molecular Weight | 675.53 g/mol |
| Exact Mass | 675.13 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-iodopurin-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)O[C@H]2n1cnc2c(N)nc(I)nc21 |
| InChI | InChI=1S/C32H30IN5O4/c1-31(2)41-25-23(40-29(26(25)42-31)38-19-35-24-27(34)36-30(33)37-28(24)38)18-39-32(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,19,23,25-26,29H,18H2,1-2H3,(H2,34,36,37)/t23-,25-,26-,29-/m1/s1 |
| InChIKey | RFXPINPVNRANKK-CTDWIVFPSA-N |
| XLogP | 5.44 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|